C31H34N2O4 — CID 91065868
1-[3-[(4aR,10bR)-8,9-dimethoxy-1,2,3,4,4a,10b-hexahydrophenanthridin-1-yl]phenyl]-N-[(3-methoxyphenyl)methoxy]ethenamine (PubChem CID 91065868) has the molecular formula C31H34N2O4 and a molecular weight of 498.62 g/mol. Its IUPAC name is 1-[3-[(4aR,10bR)-8,9-dimethoxy-1,2,3,4,4a,10b-hexahydrophenanthridin-1-yl]phenyl]-N-[(3-methoxyphenyl)methoxy]ethenamine.
| Compound Name | 1-[3-[(4aR,10bR)-8,9-dimethoxy-1,2,3,4,4a,10b-hexahydrophenanthridin-1-yl]phenyl]-N-[(3-methoxyphenyl)methoxy]ethenamine |
|---|---|
| PubChem CID | 91065868 |
| Molecular Formula | C31H34N2O4 |
| Molecular Weight | 498.62 g/mol |
| Exact Mass | 498.25 |
| IUPAC Name | 1-[3-[(4aR,10bR)-8,9-dimethoxy-1,2,3,4,4a,10b-hexahydrophenanthridin-1-yl]phenyl]-N-[(3-methoxyphenyl)methoxy]ethenamine |
| SMILES | C=C(NOCc1cccc(OC)c1)c1cccc(C2CCC[C@H]3N=Cc4cc(OC)c(OC)cc4[C@@H]23)c1 |
| InChI | InChI=1S/C31H34N2O4/c1-20(33-37-19-21-8-5-11-25(14-21)34-2)22-9-6-10-23(15-22)26-12-7-13-28-31(26)27-17-30(36-4)29(35-3)16-24(27)18-32-28/h5-6,8-11,14-18,26,28,31,33H,1,7,12-13,19H2,2-4H3/t26?,28-,31-/m1/s1 |
| InChIKey | VZULOZOYVKJUSU-QQXLIOKXSA-N |
| XLogP | 6.26 |
| TPSA | 61.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.62 |
| LogP ≤ 5 | 6.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|