C13H17N3O2 — CID 91072472
5-[(pentylideneamino)oxymethyl]-1,3-benzoxazol-2-amine (PubChem CID 91072472) has the molecular formula C13H17N3O2 and a molecular weight of 247.30 g/mol. Its IUPAC name is 5-[(pentylideneamino)oxymethyl]-1,3-benzoxazol-2-amine.
| Compound Name | 5-[(pentylideneamino)oxymethyl]-1,3-benzoxazol-2-amine |
|---|---|
| PubChem CID | 91072472 |
| Molecular Formula | C13H17N3O2 |
| Molecular Weight | 247.30 g/mol |
| Exact Mass | 247.13 |
| IUPAC Name | 5-[(pentylideneamino)oxymethyl]-1,3-benzoxazol-2-amine |
| SMILES | CCCCC=NOCc1ccc2oc(N)nc2c1 |
| InChI | InChI=1S/C13H17N3O2/c1-2-3-4-7-15-17-9-10-5-6-12-11(8-10)16-13(14)18-12/h5-8H,2-4,9H2,1H3,(H2,14,16) |
| InChIKey | PFEBXNBXTJWFTI-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 73.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.30 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|