C16H41O4PSi4 — CID 91076456
4-phosphanylhept-2-en-4-yl tris(trimethylsilyl) silicate (PubChem CID 91076456) has the molecular formula C16H41O4PSi4 and a molecular weight of 440.82 g/mol. Its IUPAC name is 4-phosphanylhept-2-en-4-yl tris(trimethylsilyl) silicate.
| Compound Name | 4-phosphanylhept-2-en-4-yl tris(trimethylsilyl) silicate |
|---|---|
| PubChem CID | 91076456 |
| Molecular Formula | C16H41O4PSi4 |
| Molecular Weight | 440.82 g/mol |
| Exact Mass | 440.18 |
| IUPAC Name | 4-phosphanylhept-2-en-4-yl tris(trimethylsilyl) silicate |
| SMILES | CC=CC(P)(CCC)O[Si](O[Si](C)(C)C)(O[Si](C)(C)C)O[Si](C)(C)C |
| InChI | InChI=1S/C16H41O4PSi4/c1-12-14-16(21,15-13-2)17-25(18-22(3,4)5,19-23(6,7)8)20-24(9,10)11/h12,14H,13,15,21H2,1-11H3 |
| InChIKey | ALDPNVDLJMDJPM-UHFFFAOYSA-N |
| XLogP | 5.94 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.82 |
| LogP ≤ 5 | 5.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|