C18H24N2O12 — CID 91079250
methyl 4-[1-(2,5-dihydroxypyrrol-1-yl)oxycarbonyloxy-3-[(2,5-dihydroxypyrrol-1-yl)oxymethoxy]propan-2-yl]oxybutanoate (PubChem CID 91079250) has the molecular formula C18H24N2O12 and a molecular weight of 460.39 g/mol. Its IUPAC name is methyl 4-[1-(2,5-dihydroxypyrrol-1-yl)oxycarbonyloxy-3-[(2,5-dihydroxypyrrol-1-yl)oxymethoxy]propan-2-yl]oxybutanoate.
| Compound Name | methyl 4-[1-(2,5-dihydroxypyrrol-1-yl)oxycarbonyloxy-3-[(2,5-dihydroxypyrrol-1-yl)oxymethoxy]propan-2-yl]oxybutanoate |
|---|---|
| PubChem CID | 91079250 |
| Molecular Formula | C18H24N2O12 |
| Molecular Weight | 460.39 g/mol |
| Exact Mass | 460.13 |
| IUPAC Name | methyl 4-[1-(2,5-dihydroxypyrrol-1-yl)oxycarbonyloxy-3-[(2,5-dihydroxypyrrol-1-yl)oxymethoxy]propan-2-yl]oxybutanoate |
| SMILES | COC(=O)CCCOC(COCOn1c(O)ccc1O)COC(=O)On1c(O)ccc1O |
| InChI | InChI=1S/C18H24N2O12/c1-27-17(25)3-2-8-29-12(9-28-11-31-19-13(21)4-5-14(19)22)10-30-18(26)32-20-15(23)6-7-16(20)24/h4-7,12,21-24H,2-3,8-11H2,1H3 |
| InChIKey | HEUONXXVKQSGKJ-UHFFFAOYSA-N |
| XLogP | 0.12 |
| TPSA | 180.30 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.39 |
| LogP ≤ 5 | 0.12 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|