C19H29N3O11 — CID 161103587
(2,5-dioxopyrrol-1-yl) 4-[1,3-bis(methoxycarbamoyloxy)propan-2-yloxy]butanoate;ethene (PubChem CID 161103587) has the molecular formula C19H29N3O11 and a molecular weight of 475.45 g/mol. Its IUPAC name is (2,5-dioxopyrrol-1-yl) 4-[1,3-bis(methoxycarbamoyloxy)propan-2-yloxy]butanoate;ethene.
| Compound Name | (2,5-dioxopyrrol-1-yl) 4-[1,3-bis(methoxycarbamoyloxy)propan-2-yloxy]butanoate;ethene |
|---|---|
| PubChem CID | 161103587 |
| Molecular Formula | C19H29N3O11 |
| Molecular Weight | 475.45 g/mol |
| Exact Mass | 475.18 |
| IUPAC Name | (2,5-dioxopyrrol-1-yl) 4-[1,3-bis(methoxycarbamoyloxy)propan-2-yloxy]butanoate;ethene |
| SMILES | C=C.C=C.CONC(=O)OCC(COC(=O)NOC)OCCCC(=O)ON1C(=O)C=CC1=O |
| InChI | InChI=1S/C15H21N3O11.2C2H4/c1-24-16-14(22)27-8-10(9-28-15(23)17-25-2)26-7-3-4-13(21)29-18-11(19)5-6-12(18)20;2*1-2/h5-6,10H,3-4,7-9H2,1-2H3,(H,16,22)(H,17,23);2*1-2H2 |
| InChIKey | UITHZRIDOIUEMS-UHFFFAOYSA-N |
| XLogP | 0.71 |
| TPSA | 168.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.45 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|