C20H44N4 — CID 91083918
1,2,5,5,7,8,9,12,12,14-decamethyl-1,4,8,11-tetrazacyclotetradecane (PubChem CID 91083918) has the molecular formula C20H44N4 and a molecular weight of 340.60 g/mol. Its IUPAC name is 1,2,5,5,7,8,9,12,12,14-decamethyl-1,4,8,11-tetrazacyclotetradecane.
| Compound Name | 1,2,5,5,7,8,9,12,12,14-decamethyl-1,4,8,11-tetrazacyclotetradecane |
|---|---|
| PubChem CID | 91083918 |
| Molecular Formula | C20H44N4 |
| Molecular Weight | 340.60 g/mol |
| Exact Mass | 340.36 |
| IUPAC Name | 1,2,5,5,7,8,9,12,12,14-decamethyl-1,4,8,11-tetrazacyclotetradecane |
| SMILES | CC1CNC(C)(C)CC(C)N(C)C(C)CNC(C)(C)CC(C)N1C |
| InChI | InChI=1S/C20H44N4/c1-15-11-19(5,6)21-14-18(4)24(10)16(2)12-20(7,8)22-13-17(3)23(15)9/h15-18,21-22H,11-14H2,1-10H3 |
| InChIKey | AVIXOAHLLKKXLP-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 30.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.60 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |