C27H44N4O4S2 — CID 91085390
2,14-bis(3-ethyl-5-hydroxy-2-sulfanylideneimidazol-1-yl)-2,14-dimethylpentadecane-6,10-dione (PubChem CID 91085390) has the molecular formula C27H44N4O4S2 and a molecular weight of 552.81 g/mol. Its IUPAC name is 2,14-bis(3-ethyl-5-hydroxy-2-sulfanylideneimidazol-1-yl)-2,14-dimethylpentadecane-6,10-dione.
| Compound Name | 2,14-bis(3-ethyl-5-hydroxy-2-sulfanylideneimidazol-1-yl)-2,14-dimethylpentadecane-6,10-dione |
|---|---|
| PubChem CID | 91085390 |
| Molecular Formula | C27H44N4O4S2 |
| Molecular Weight | 552.81 g/mol |
| Exact Mass | 552.28 |
| IUPAC Name | 2,14-bis(3-ethyl-5-hydroxy-2-sulfanylideneimidazol-1-yl)-2,14-dimethylpentadecane-6,10-dione |
| SMILES | CCn1cc(O)n(C(C)(C)CCCC(=O)CCCC(=O)CCCC(C)(C)n2c(O)cn(CC)c2=S)c1=S |
| InChI | InChI=1S/C27H44N4O4S2/c1-7-28-18-22(34)30(24(28)36)26(3,4)16-10-14-20(32)12-9-13-21(33)15-11-17-27(5,6)31-23(35)19-29(8-2)25(31)37/h18-19,34-35H,7-17H2,1-6H3 |
| InChIKey | CRIGWVQWOJUKSO-UHFFFAOYSA-N |
| XLogP | 6.62 |
| TPSA | 94.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.81 |
| LogP ≤ 5 | 6.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|