C17H23N4O4S+ — CID 9108619
N,N-diethyl-4-[(1R)-1-[(3-nitropyridin-1-ium-2-yl)amino]ethyl]benzenesulfonamide (PubChem CID 9108619) has the molecular formula C17H23N4O4S+ and a molecular weight of 379.46 g/mol. Its IUPAC name is N,N-diethyl-4-[(1R)-1-[(3-nitropyridin-1-ium-2-yl)amino]ethyl]benzenesulfonamide.
| Compound Name | N,N-diethyl-4-[(1R)-1-[(3-nitropyridin-1-ium-2-yl)amino]ethyl]benzenesulfonamide |
|---|---|
| PubChem CID | 9108619 |
| Molecular Formula | C17H23N4O4S+ |
| Molecular Weight | 379.46 g/mol |
| Exact Mass | 379.14 |
| IUPAC Name | N,N-diethyl-4-[(1R)-1-[(3-nitropyridin-1-ium-2-yl)amino]ethyl]benzenesulfonamide |
| SMILES | CCN(CC)S(=O)(=O)c1ccc([C@@H](C)Nc2[nH+]cccc2[N+](=O)[O-])cc1 |
| InChI | InChI=1S/C17H22N4O4S/c1-4-20(5-2)26(24,25)15-10-8-14(9-11-15)13(3)19-17-16(21(22)23)7-6-12-18-17/h6-13H,4-5H2,1-3H3,(H,18,19)/p+1/t13-/m1/s1 |
| InChIKey | CDXUTXHMODGPSJ-CYBMUJFWSA-O |
| XLogP | 2.61 |
| TPSA | 106.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.46 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|