C12H13NO — CID 91091154
1-(1,2,3,4-tetrahydroisoquinolin-7-yl)prop-2-yn-1-ol (PubChem CID 91091154) has the molecular formula C12H13NO and a molecular weight of 187.24 g/mol. Its IUPAC name is 1-(1,2,3,4-tetrahydroisoquinolin-7-yl)prop-2-yn-1-ol.
| Compound Name | 1-(1,2,3,4-tetrahydroisoquinolin-7-yl)prop-2-yn-1-ol |
|---|---|
| PubChem CID | 91091154 |
| Molecular Formula | C12H13NO |
| Molecular Weight | 187.24 g/mol |
| Exact Mass | 187.10 |
| IUPAC Name | 1-(1,2,3,4-tetrahydroisoquinolin-7-yl)prop-2-yn-1-ol |
| SMILES | C#CC(O)c1ccc2c(c1)CNCC2 |
| InChI | InChI=1S/C12H13NO/c1-2-12(14)10-4-3-9-5-6-13-8-11(9)7-10/h1,3-4,7,12-14H,5-6,8H2 |
| InChIKey | PRBKZCJXGFZIMP-UHFFFAOYSA-N |
| XLogP | 1.00 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 187.24 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|