C22H24BrN3O2 — CID 91092630
6'-bromo-2-methyl-2'-(6-methyl-1,2,3,4-tetrahydronaphthalen-1-yl)spiro[1,2,4-oxadiazole-5,4'-2,3-dihydrochromene]-3-amine (PubChem CID 91092630) has the molecular formula C22H24BrN3O2 and a molecular weight of 442.36 g/mol. Its IUPAC name is 6'-bromo-2-methyl-2'-(6-methyl-1,2,3,4-tetrahydronaphthalen-1-yl)spiro[1,2,4-oxadiazole-5,4'-2,3-dihydrochromene]-3-amine.
| Compound Name | 6'-bromo-2-methyl-2'-(6-methyl-1,2,3,4-tetrahydronaphthalen-1-yl)spiro[1,2,4-oxadiazole-5,4'-2,3-dihydrochromene]-3-amine |
|---|---|
| PubChem CID | 91092630 |
| Molecular Formula | C22H24BrN3O2 |
| Molecular Weight | 442.36 g/mol |
| Exact Mass | 441.11 |
| IUPAC Name | 6'-bromo-2-methyl-2'-(6-methyl-1,2,3,4-tetrahydronaphthalen-1-yl)spiro[1,2,4-oxadiazole-5,4'-2,3-dihydrochromene]-3-amine |
| SMILES | Cc1ccc2c(c1)CCCC2C1CC2(N=C(N)N(C)O2)c2cc(Br)ccc2O1 |
| InChI | InChI=1S/C22H24BrN3O2/c1-13-6-8-16-14(10-13)4-3-5-17(16)20-12-22(25-21(24)26(2)28-22)18-11-15(23)7-9-19(18)27-20/h6-11,17,20H,3-5,12H2,1-2H3,(H2,24,25) |
| InChIKey | ZCWBWUYPBOTZLG-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 60.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.36 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |