C10H9BN2 — CID 91097985
6-phenyl-1,3-azaborinin-2-amine (PubChem CID 91097985) has the molecular formula C10H9BN2 and a molecular weight of 168.01 g/mol. Its IUPAC name is 6-phenyl-1,3-azaborinin-2-amine.
| Compound Name | 6-phenyl-1,3-azaborinin-2-amine |
|---|---|
| PubChem CID | 91097985 |
| Molecular Formula | C10H9BN2 |
| Molecular Weight | 168.01 g/mol |
| Exact Mass | 168.09 |
| IUPAC Name | 6-phenyl-1,3-azaborinin-2-amine |
| SMILES | Nc1bccc(-c2ccccc2)n1 |
| InChI | InChI=1S/C10H9BN2/c12-10-11-7-6-9(13-10)8-4-2-1-3-5-8/h1-7H,(H2,12,13) |
| InChIKey | XSFAYRVEQAMXCR-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 168.01 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |