C26H23F2N3O4 — CID 91100080
(1S,9aR)-6-(3,4-difluorophenyl)-3-[[3-methoxy-4-(4-methylimidazol-1-yl)phenyl]methylidene]-1-methyl-9,9a-dihydro-1H-[1,4]oxazino[3,4-c][1,4]oxazin-4-one (PubChem CID 91100080) has the molecular formula C26H23F2N3O4 and a molecular weight of 479.48 g/mol. Its IUPAC name is (1S,9aR)-6-(3,4-difluorophenyl)-3-[[3-methoxy-4-(4-methylimidazol-1-yl)phenyl]methylidene]-1-methyl-9,9a-dihydro-1H-[1,4]oxazino[3,4-c][1,4]oxazin-4-one.
| Compound Name | (1S,9aR)-6-(3,4-difluorophenyl)-3-[[3-methoxy-4-(4-methylimidazol-1-yl)phenyl]methylidene]-1-methyl-9,9a-dihydro-1H-[1,4]oxazino[3,4-c][1,4]oxazin-4-one |
|---|---|
| PubChem CID | 91100080 |
| Molecular Formula | C26H23F2N3O4 |
| Molecular Weight | 479.48 g/mol |
| Exact Mass | 479.17 |
| IUPAC Name | (1S,9aR)-6-(3,4-difluorophenyl)-3-[[3-methoxy-4-(4-methylimidazol-1-yl)phenyl]methylidene]-1-methyl-9,9a-dihydro-1H-[1,4]oxazino[3,4-c][1,4]oxazin-4-one |
| SMILES | COc1cc(C=C2O[C@@H](C)[C@H]3COC=C(c4ccc(F)c(F)c4)N3C2=O)ccc1-n1cnc(C)c1 |
| InChI | InChI=1S/C26H23F2N3O4/c1-15-11-30(14-29-15)21-7-4-17(8-24(21)33-3)9-25-26(32)31-22(16(2)35-25)12-34-13-23(31)18-5-6-19(27)20(28)10-18/h4-11,13-14,16,22H,12H2,1-3H3/t16-,22+/m0/s1 |
| InChIKey | FTRUYQKPNNKWQX-KSFYIVLOSA-N |
| XLogP | 4.45 |
| TPSA | 65.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.48 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|