C34H39N7O4S — CID 91100399
4-[3-[3-oxo-4-[[3-[5-(2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl)pentanoylamino]propylamino]methyl]cyclohexa-1,5-dien-1-yl]indazol-1-yl]benzamide (PubChem CID 91100399) has the molecular formula C34H39N7O4S and a molecular weight of 641.80 g/mol. Its IUPAC name is 4-[3-[3-oxo-4-[[3-[5-(2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl)pentanoylamino]propylamino]methyl]cyclohexa-1,5-dien-1-yl]indazol-1-yl]benzamide.
| Compound Name | 4-[3-[3-oxo-4-[[3-[5-(2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl)pentanoylamino]propylamino]methyl]cyclohexa-1,5-dien-1-yl]indazol-1-yl]benzamide |
|---|---|
| PubChem CID | 91100399 |
| Molecular Formula | C34H39N7O4S |
| Molecular Weight | 641.80 g/mol |
| Exact Mass | 641.28 |
| IUPAC Name | 4-[3-[3-oxo-4-[[3-[5-(2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl)pentanoylamino]propylamino]methyl]cyclohexa-1,5-dien-1-yl]indazol-1-yl]benzamide |
| SMILES | NC(=O)c1ccc(-n2nc(C3=CC(=O)C(CNCCCNC(=O)CCCCC4SCC5NC(=O)NC54)C=C3)c3ccccc32)cc1 |
| InChI | InChI=1S/C34H39N7O4S/c35-33(44)21-12-14-24(15-13-21)41-27-7-2-1-6-25(27)31(40-41)22-10-11-23(28(42)18-22)19-36-16-5-17-37-30(43)9-4-3-8-29-32-26(20-46-29)38-34(45)39-32/h1-2,6-7,10-15,18,23,26,29,32,36H,3-5,8-9,16-17,19-20H2,(H2,35,44)(H,37,43)(H2,38,39,45) |
| InChIKey | BUGVVBZDZKUUOE-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 160.24 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 46 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 641.80 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'biotin_analogue', 'substructure': 'N/A'} |
|---|