C16H25NO3 — CID 91101777
4-benzyl-5-hydroxy-5-[(2-methylpropan-2-yl)oxy]pentanamide (PubChem CID 91101777) has the molecular formula C16H25NO3 and a molecular weight of 279.38 g/mol. Its IUPAC name is 4-benzyl-5-hydroxy-5-[(2-methylpropan-2-yl)oxy]pentanamide.
| Compound Name | 4-benzyl-5-hydroxy-5-[(2-methylpropan-2-yl)oxy]pentanamide |
|---|---|
| PubChem CID | 91101777 |
| Molecular Formula | C16H25NO3 |
| Molecular Weight | 279.38 g/mol |
| Exact Mass | 279.18 |
| IUPAC Name | 4-benzyl-5-hydroxy-5-[(2-methylpropan-2-yl)oxy]pentanamide |
| SMILES | CC(C)(C)OC(O)C(CCC(N)=O)Cc1ccccc1 |
| InChI | InChI=1S/C16H25NO3/c1-16(2,3)20-15(19)13(9-10-14(17)18)11-12-7-5-4-6-8-12/h4-8,13,15,19H,9-11H2,1-3H3,(H2,17,18) |
| InChIKey | RXKMIFCRLCQXIC-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 72.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.38 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|