C11H5Cl17O2 — CID 91102486
3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-heptadecachlorodecan-2-yl formate (PubChem CID 91102486) has the molecular formula C11H5Cl17O2 and a molecular weight of 771.86 g/mol. Its IUPAC name is 3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-heptadecachlorodecan-2-yl formate.
| Compound Name | 3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-heptadecachlorodecan-2-yl formate |
|---|---|
| PubChem CID | 91102486 |
| Molecular Formula | C11H5Cl17O2 |
| Molecular Weight | 771.86 g/mol |
| Exact Mass | 763.50 |
| IUPAC Name | 3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-heptadecachlorodecan-2-yl formate |
| SMILES | CC(OC=O)C(Cl)(Cl)C(Cl)(Cl)C(Cl)(Cl)C(Cl)(Cl)C(Cl)(Cl)C(Cl)(Cl)C(Cl)(Cl)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C11H5Cl17O2/c1-3(30-2-29)4(12,13)5(14,15)6(16,17)7(18,19)8(20,21)9(22,23)10(24,25)11(26,27)28/h2-3H,1H3 |
| InChIKey | YMXMFVYGDKSBJM-UHFFFAOYSA-N |
| XLogP | 10.14 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 771.86 |
| LogP ≤ 5 | 10.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|