C4H6O8 — CID 91102558
3,3,4,4,5,5-hexahydroxyoxolan-2-one (PubChem CID 91102558) has the molecular formula C4H6O8 and a molecular weight of 182.08 g/mol. Its IUPAC name is 3,3,4,4,5,5-hexahydroxyoxolan-2-one.
| Compound Name | 3,3,4,4,5,5-hexahydroxyoxolan-2-one |
|---|---|
| PubChem CID | 91102558 |
| Molecular Formula | C4H6O8 |
| Molecular Weight | 182.08 g/mol |
| Exact Mass | 182.01 |
| IUPAC Name | 3,3,4,4,5,5-hexahydroxyoxolan-2-one |
| SMILES | O=C1OC(O)(O)C(O)(O)C1(O)O |
| InChI | InChI=1S/C4H6O8/c5-1-2(6,7)3(8,9)4(10,11)12-1/h6-11H |
| InChIKey | RIWVYTVGPYHJQB-UHFFFAOYSA-N |
| XLogP | -4.46 |
| TPSA | 147.68 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.08 |
| LogP ≤ 5 | -4.46 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|