C6H8I2O6 — CID 163745606
4,4,5,5-tetrahydroxy-3,3-bis(methylidene-λ3-iodanyl)oxolan-2-one (PubChem CID 163745606) has the molecular formula C6H8I2O6 and a molecular weight of 429.93 g/mol. Its IUPAC name is 4,4,5,5-tetrahydroxy-3,3-bis(methylidene-λ3-iodanyl)oxolan-2-one.
| Compound Name | 4,4,5,5-tetrahydroxy-3,3-bis(methylidene-λ3-iodanyl)oxolan-2-one |
|---|---|
| PubChem CID | 163745606 |
| Molecular Formula | C6H8I2O6 |
| Molecular Weight | 429.93 g/mol |
| Exact Mass | 429.84 |
| IUPAC Name | 4,4,5,5-tetrahydroxy-3,3-bis(methylidene-λ3-iodanyl)oxolan-2-one |
| SMILES | C=IC1(I=C)C(=O)OC(O)(O)C1(O)O |
| InChI | InChI=1S/C6H8I2O6/c1-7-4(8-2)3(9)14-6(12,13)5(4,10)11/h10-13H,1-2H2 |
| InChIKey | LLPAWWZFYRYODZ-UHFFFAOYSA-N |
| XLogP | -1.64 |
| TPSA | 107.22 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.93 |
| LogP ≤ 5 | -1.64 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|