C31H50O3 — CID 91108694
(1R,2R,5R,10S,11R,14R,15R,19S)-17-methoxy-1,2,5,9,15,20,20-heptamethyl-8-methylidene-18-oxahexacyclo[12.9.0.02,11.05,10.015,21.017,19]tricosan-19-ol (PubChem CID 91108694) has the molecular formula C31H50O3 and a molecular weight of 470.74 g/mol. Its IUPAC name is (1R,2R,5R,10S,11R,14R,15R,19S)-17-methoxy-1,2,5,9,15,20,20-heptamethyl-8-methylidene-18-oxahexacyclo[12.9.0.02,11.05,10.015,21.017,19]tricosan-19-ol.
| Compound Name | (1R,2R,5R,10S,11R,14R,15R,19S)-17-methoxy-1,2,5,9,15,20,20-heptamethyl-8-methylidene-18-oxahexacyclo[12.9.0.02,11.05,10.015,21.017,19]tricosan-19-ol |
|---|---|
| PubChem CID | 91108694 |
| Molecular Formula | C31H50O3 |
| Molecular Weight | 470.74 g/mol |
| Exact Mass | 470.38 |
| IUPAC Name | (1R,2R,5R,10S,11R,14R,15R,19S)-17-methoxy-1,2,5,9,15,20,20-heptamethyl-8-methylidene-18-oxahexacyclo[12.9.0.02,11.05,10.015,21.017,19]tricosan-19-ol |
| SMILES | C=C1CC[C@]2(C)CC[C@]3(C)[C@H](CC[C@@H]4[C@@]5(C)CC6(OC)O[C@@]6(O)C(C)(C)C5CC[C@]43C)[C@@H]2C1C |
| InChI | InChI=1S/C31H50O3/c1-19-12-14-26(5)16-17-28(7)21(24(26)20(19)2)10-11-23-27(6)18-30(33-9)31(32,34-30)25(3,4)22(27)13-15-29(23,28)8/h20-24,32H,1,10-18H2,2-9H3/t20?,21-,22?,23-,24+,26-,27+,28-,29-,30?,31+/m1/s1 |
| InChIKey | KMEBZHFLCUQUID-RYDHVSKISA-N |
| XLogP | 7.34 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.74 |
| LogP ≤ 5 | 7.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|