C33H44N2O7 — CID 91109254
(4R,4aR,5aS,12aR)-4-(dimethylamino)-10,12a-dihydroxy-9-[1-(4-methylcyclohexyl)pentyl]-1,3,11,12-tetraoxo-4,4a,5,5a,6,11a-hexahydrotetracene-2-carboxamide (PubChem CID 91109254) has the molecular formula C33H44N2O7 and a molecular weight of 580.72 g/mol. Its IUPAC name is (4R,4aR,5aS,12aR)-4-(dimethylamino)-10,12a-dihydroxy-9-[1-(4-methylcyclohexyl)pentyl]-1,3,11,12-tetraoxo-4,4a,5,5a,6,11a-hexahydrotetracene-2-carboxamide.
| Compound Name | (4R,4aR,5aS,12aR)-4-(dimethylamino)-10,12a-dihydroxy-9-[1-(4-methylcyclohexyl)pentyl]-1,3,11,12-tetraoxo-4,4a,5,5a,6,11a-hexahydrotetracene-2-carboxamide |
|---|---|
| PubChem CID | 91109254 |
| Molecular Formula | C33H44N2O7 |
| Molecular Weight | 580.72 g/mol |
| Exact Mass | 580.31 |
| IUPAC Name | (4R,4aR,5aS,12aR)-4-(dimethylamino)-10,12a-dihydroxy-9-[1-(4-methylcyclohexyl)pentyl]-1,3,11,12-tetraoxo-4,4a,5,5a,6,11a-hexahydrotetracene-2-carboxamide |
| SMILES | CCCCC(c1ccc2c(c1O)C(=O)C1C(=O)[C@@]3(O)C(=O)C(C(N)=O)C(=O)[C@H](N(C)C)[C@H]3C[C@H]1C2)C1CCC(C)CC1 |
| InChI | InChI=1S/C33H44N2O7/c1-5-6-7-20(17-10-8-16(2)9-11-17)21-13-12-18-14-19-15-22-26(35(3)4)29(38)25(32(34)41)31(40)33(22,42)30(39)24(19)28(37)23(18)27(21)36/h12-13,16-17,19-20,22,24-26,36,42H,5-11,14-15H2,1-4H3,(H2,34,41)/t16?,17?,19-,20?,22-,24?,25?,26-,33-/m1/s1 |
| InChIKey | HDYVBEIHQKEXRV-HBZOSCRWSA-N |
| XLogP | 2.97 |
| TPSA | 155.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.72 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|