C15H24O3 — CID 91110339
4-(6,6-dimethyl-2-bicyclo[3.1.1]hept-2-enyl)-2-(hydroxymethyl)-2-methylbutanoic acid (PubChem CID 91110339) has the molecular formula C15H24O3 and a molecular weight of 252.35 g/mol. Its IUPAC name is 4-(6,6-dimethyl-2-bicyclo[3.1.1]hept-2-enyl)-2-(hydroxymethyl)-2-methylbutanoic acid.
| Compound Name | 4-(6,6-dimethyl-2-bicyclo[3.1.1]hept-2-enyl)-2-(hydroxymethyl)-2-methylbutanoic acid |
|---|---|
| PubChem CID | 91110339 |
| Molecular Formula | C15H24O3 |
| Molecular Weight | 252.35 g/mol |
| Exact Mass | 252.17 |
| IUPAC Name | 4-(6,6-dimethyl-2-bicyclo[3.1.1]hept-2-enyl)-2-(hydroxymethyl)-2-methylbutanoic acid |
| SMILES | CC(CO)(CCC1=CCC2CC1C2(C)C)C(=O)O |
| InChI | InChI=1S/C15H24O3/c1-14(2)11-5-4-10(12(14)8-11)6-7-15(3,9-16)13(17)18/h4,11-12,16H,5-9H2,1-3H3,(H,17,18) |
| InChIKey | HJBXORFOMHIQAV-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.35 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|