C20H18F2N4O — CID 9112272
2,4-difluoro-N-[(Z)-(2-morpholin-4-ylquinolin-3-yl)methylideneamino]aniline (PubChem CID 9112272) has the molecular formula C20H18F2N4O and a molecular weight of 368.39 g/mol. Its IUPAC name is 2,4-difluoro-N-[(Z)-(2-morpholin-4-ylquinolin-3-yl)methylideneamino]aniline.
| Compound Name | 2,4-difluoro-N-[(Z)-(2-morpholin-4-ylquinolin-3-yl)methylideneamino]aniline |
|---|---|
| PubChem CID | 9112272 |
| Molecular Formula | C20H18F2N4O |
| Molecular Weight | 368.39 g/mol |
| Exact Mass | 368.14 |
| IUPAC Name | 2,4-difluoro-N-[(Z)-(2-morpholin-4-ylquinolin-3-yl)methylideneamino]aniline |
| SMILES | Fc1ccc(N/N=C\c2cc3ccccc3nc2N2CCOCC2)c(F)c1 |
| InChI | InChI=1S/C20H18F2N4O/c21-16-5-6-19(17(22)12-16)25-23-13-15-11-14-3-1-2-4-18(14)24-20(15)26-7-9-27-10-8-26/h1-6,11-13,25H,7-10H2/b23-13- |
| InChIKey | LZFKPWUYIFNJSJ-QRVIBDJDSA-N |
| XLogP | 3.80 |
| TPSA | 49.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.39 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|