About N-(2,4-difluorophenyl)-5-morpholin-4-ylpyrido[2,3-d]pyridazin-2-amine
N-(2,4-difluorophenyl)-5-morpholin-4-ylpyrido[2,3-d]pyridazin-2-amine (PubChem CID 46205512) has the molecular formula C17H15F2N5O
and a molecular weight of 343.34 g/mol. Its IUPAC name is N-(2,4-difluorophenyl)-5-morpholin-4-ylpyrido[2,3-d]pyridazin-2-amine.
Molecular Properties
| Compound Name | N-(2,4-difluorophenyl)-5-morpholin-4-ylpyrido[2,3-d]pyridazin-2-amine |
| PubChem CID | 46205512 |
| Molecular Formula | C17H15F2N5O |
| Molecular Weight | 343.34 g/mol |
| Exact Mass | 343.12 |
| IUPAC Name | N-(2,4-difluorophenyl)-5-morpholin-4-ylpyrido[2,3-d]pyridazin-2-amine |
| SMILES | Fc1ccc(Nc2ccc3c(N4CCOCC4)nncc3n2)c(F)c1 |
| InChI | InChI=1S/C17H15F2N5O/c18-11-1-3-14(13(19)9-11)21-16-4-2-12-15(22-16)10-20-23-17(12)24-5-7-25-8-6-24/h1-4,9-10H,5-8H2,(H,21,22) |
| InChIKey | KYOFTOMECCWPBR-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 63.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 343.34 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze N-(2,4-difluorophenyl)-5-morpholin-4-ylpyrido[2,3-d]pyridazin-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(2,4-difluorophenyl)-5-morpholin-4-ylpyrido[2,3-d]pyridazin-2-amine?
The IUPAC name of N-(2,4-difluorophenyl)-5-morpholin-4-ylpyrido[2,3-d]pyridazin-2-amine (CID 46205512) is N-(2,4-difluorophenyl)-5-morpholin-4-ylpyrido[2,3-d]pyridazin-2-amine.
What is the SMILES notation for N-(2,4-difluorophenyl)-5-morpholin-4-ylpyrido[2,3-d]pyridazin-2-amine?
The canonical SMILES for N-(2,4-difluorophenyl)-5-morpholin-4-ylpyrido[2,3-d]pyridazin-2-amine is Fc1ccc(Nc2ccc3c(N4CCOCC4)nncc3n2)c(F)c1.
What is the InChIKey of N-(2,4-difluorophenyl)-5-morpholin-4-ylpyrido[2,3-d]pyridazin-2-amine?
The InChIKey is KYOFTOMECCWPBR-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H15F2N5O/c18-11-1-3-14(13(19)9-11)21-16-4-2-12-15(22-16)10-20-23-17(12)24-5-7-25-8-6-24/h1-4,9-10H,5-8H2,(H,21,22).
What are the key properties of N-(2,4-difluorophenyl)-5-morpholin-4-ylpyrido[2,3-d]pyridazin-2-amine?
N-(2,4-difluorophenyl)-5-morpholin-4-ylpyrido[2,3-d]pyridazin-2-amine has a molecular weight of 343.34 g/mol, XLogP of 2.88, 3 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for N-(2,4-difluorophenyl)-5-morpholin-4-ylpyrido[2,3-d]pyridazin-2-amine is sourced from PubChem (CID 46205512), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).