C17H15F2N5O — CID 46205512
N-(2,4-difluorophenyl)-5-morpholin-4-ylpyrido[2,3-d]pyridazin-2-amine (PubChem CID 46205512) has the molecular formula C17H15F2N5O and a molecular weight of 343.34 g/mol. Its IUPAC name is N-(2,4-difluorophenyl)-5-morpholin-4-ylpyrido[2,3-d]pyridazin-2-amine.
| Compound Name | N-(2,4-difluorophenyl)-5-morpholin-4-ylpyrido[2,3-d]pyridazin-2-amine |
|---|---|
| PubChem CID | 46205512 |
| Molecular Formula | C17H15F2N5O |
| Molecular Weight | 343.34 g/mol |
| Exact Mass | 343.12 |
| IUPAC Name | N-(2,4-difluorophenyl)-5-morpholin-4-ylpyrido[2,3-d]pyridazin-2-amine |
| SMILES | Fc1ccc(Nc2ccc3c(N4CCOCC4)nncc3n2)c(F)c1 |
| InChI | InChI=1S/C17H15F2N5O/c18-11-1-3-14(13(19)9-11)21-16-4-2-12-15(22-16)10-20-23-17(12)24-5-7-25-8-6-24/h1-4,9-10H,5-8H2,(H,21,22) |
| InChIKey | KYOFTOMECCWPBR-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 63.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.34 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |