C25H18F2N2O7 — CID 91124860
[6'-acetyloxy-4-(aminomethylamino)-2',7'-difluoro-3-oxospiro[2-benzofuran-1,9'-xanthene]-3'-yl] acetate (PubChem CID 91124860) has the molecular formula C25H18F2N2O7 and a molecular weight of 496.42 g/mol. Its IUPAC name is [6'-acetyloxy-4-(aminomethylamino)-2',7'-difluoro-3-oxospiro[2-benzofuran-1,9'-xanthene]-3'-yl] acetate.
| Compound Name | [6'-acetyloxy-4-(aminomethylamino)-2',7'-difluoro-3-oxospiro[2-benzofuran-1,9'-xanthene]-3'-yl] acetate |
|---|---|
| PubChem CID | 91124860 |
| Molecular Formula | C25H18F2N2O7 |
| Molecular Weight | 496.42 g/mol |
| Exact Mass | 496.11 |
| IUPAC Name | [6'-acetyloxy-4-(aminomethylamino)-2',7'-difluoro-3-oxospiro[2-benzofuran-1,9'-xanthene]-3'-yl] acetate |
| SMILES | CC(=O)Oc1cc2c(cc1F)C1(OC(=O)c3c(NCN)cccc31)c1cc(F)c(OC(C)=O)cc1O2 |
| InChI | InChI=1S/C25H18F2N2O7/c1-11(30)33-21-8-19-14(6-16(21)26)25(13-4-3-5-18(29-10-28)23(13)24(32)36-25)15-7-17(27)22(34-12(2)31)9-20(15)35-19/h3-9,29H,10,28H2,1-2H3 |
| InChIKey | PIMMNUQRFSJYPF-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 126.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.42 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|