C24H16F2N2O7 — CID 18522191
(6'-acetyloxy-4,5-diamino-2',7'-difluoro-3-oxospiro[2-benzofuran-1,9'-xanthene]-3'-yl) acetate (PubChem CID 18522191) has the molecular formula C24H16F2N2O7 and a molecular weight of 482.40 g/mol. Its IUPAC name is (6'-acetyloxy-4,5-diamino-2',7'-difluoro-3-oxospiro[2-benzofuran-1,9'-xanthene]-3'-yl) acetate.
| Compound Name | (6'-acetyloxy-4,5-diamino-2',7'-difluoro-3-oxospiro[2-benzofuran-1,9'-xanthene]-3'-yl) acetate |
|---|---|
| PubChem CID | 18522191 |
| Molecular Formula | C24H16F2N2O7 |
| Molecular Weight | 482.40 g/mol |
| Exact Mass | 482.09 |
| IUPAC Name | (6'-acetyloxy-4,5-diamino-2',7'-difluoro-3-oxospiro[2-benzofuran-1,9'-xanthene]-3'-yl) acetate |
| SMILES | CC(=O)Oc1cc2c(cc1F)C1(OC(=O)c3c1ccc(N)c3N)c1cc(F)c(OC(C)=O)cc1O2 |
| InChI | InChI=1S/C24H16F2N2O7/c1-9(29)32-19-7-17-12(5-14(19)25)24(11-3-4-16(27)22(28)21(11)23(31)35-24)13-6-15(26)20(33-10(2)30)8-18(13)34-17/h3-8H,27-28H2,1-2H3 |
| InChIKey | UGAFCIYZIMLJKY-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 140.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.40 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|