C25H18F2N2O7 — CID 22967144
methyl 6'-acetyloxy-4-amino-2',7'-difluoro-5-(methylamino)-3-oxospiro[2-benzofuran-1,9'-xanthene]-3'-carboxylate (PubChem CID 22967144) has the molecular formula C25H18F2N2O7 and a molecular weight of 496.42 g/mol. Its IUPAC name is methyl 6'-acetyloxy-4-amino-2',7'-difluoro-5-(methylamino)-3-oxospiro[2-benzofuran-1,9'-xanthene]-3'-carboxylate.
| Compound Name | methyl 6'-acetyloxy-4-amino-2',7'-difluoro-5-(methylamino)-3-oxospiro[2-benzofuran-1,9'-xanthene]-3'-carboxylate |
|---|---|
| PubChem CID | 22967144 |
| Molecular Formula | C25H18F2N2O7 |
| Molecular Weight | 496.42 g/mol |
| Exact Mass | 496.11 |
| IUPAC Name | methyl 6'-acetyloxy-4-amino-2',7'-difluoro-5-(methylamino)-3-oxospiro[2-benzofuran-1,9'-xanthene]-3'-carboxylate |
| SMILES | CNc1ccc2c(c1N)C(=O)OC21c2cc(F)c(OC(C)=O)cc2Oc2cc(C(=O)OC)c(F)cc21 |
| InChI | InChI=1S/C25H18F2N2O7/c1-10(30)34-20-9-19-14(8-16(20)27)25(12-4-5-17(29-2)22(28)21(12)24(32)36-25)13-7-15(26)11(23(31)33-3)6-18(13)35-19/h4-9,29H,28H2,1-3H3 |
| InChIKey | GDOHAWDIZIEPBI-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 126.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.42 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|