C28H28N3O6S- — CID 91126206
2-[[4-[4-[(4-methoxy-4-oxobutyl)-sulfinatoamino]phenyl]phenyl]carbamoyl]-3-methyl-4-(methylamino)-1-benzofuran (PubChem CID 91126206) has the molecular formula C28H28N3O6S- and a molecular weight of 534.61 g/mol. Its IUPAC name is 2-[[4-[4-[(4-methoxy-4-oxobutyl)-sulfinatoamino]phenyl]phenyl]carbamoyl]-3-methyl-4-(methylamino)-1-benzofuran.
| Compound Name | 2-[[4-[4-[(4-methoxy-4-oxobutyl)-sulfinatoamino]phenyl]phenyl]carbamoyl]-3-methyl-4-(methylamino)-1-benzofuran |
|---|---|
| PubChem CID | 91126206 |
| Molecular Formula | C28H28N3O6S- |
| Molecular Weight | 534.61 g/mol |
| Exact Mass | 534.17 |
| IUPAC Name | 2-[[4-[4-[(4-methoxy-4-oxobutyl)-sulfinatoamino]phenyl]phenyl]carbamoyl]-3-methyl-4-(methylamino)-1-benzofuran |
| SMILES | CNc1cccc2oc(C(=O)Nc3ccc(-c4ccc(N(CCCC(=O)OC)S(=O)[O-])cc4)cc3)c(C)c12 |
| InChI | InChI=1S/C28H29N3O6S/c1-18-26-23(29-2)6-4-7-24(26)37-27(18)28(33)30-21-13-9-19(10-14-21)20-11-15-22(16-12-20)31(38(34)35)17-5-8-25(32)36-3/h4,6-7,9-16,29H,5,8,17H2,1-3H3,(H,30,33)(H,34,35)/p-1 |
| InChIKey | SAYQOKJQLUPKCY-UHFFFAOYSA-M |
| XLogP | 5.26 |
| TPSA | 123.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.61 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|