C14H27NO2 — CID 91126366
1-hydroxy-2,3,6-trimethyl-2,6-dipropylpiperidin-4-one (PubChem CID 91126366) has the molecular formula C14H27NO2 and a molecular weight of 241.37 g/mol. Its IUPAC name is 1-hydroxy-2,3,6-trimethyl-2,6-dipropylpiperidin-4-one.
| Compound Name | 1-hydroxy-2,3,6-trimethyl-2,6-dipropylpiperidin-4-one |
|---|---|
| PubChem CID | 91126366 |
| Molecular Formula | C14H27NO2 |
| Molecular Weight | 241.37 g/mol |
| Exact Mass | 241.20 |
| IUPAC Name | 1-hydroxy-2,3,6-trimethyl-2,6-dipropylpiperidin-4-one |
| SMILES | CCCC1(C)CC(=O)C(C)C(C)(CCC)N1O |
| InChI | InChI=1S/C14H27NO2/c1-6-8-13(4)10-12(16)11(3)14(5,9-7-2)15(13)17/h11,17H,6-10H2,1-5H3 |
| InChIKey | HBMKSRUACBVJCU-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.37 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |