C37H38N2O5 — CID 91126678
ethyl 3-[[4-[[2-(4-tert-butylphenoxy)-1-(9H-fluoren-2-yl)-2-oxoethyl]amino]benzoyl]amino]propanoate (PubChem CID 91126678) has the molecular formula C37H38N2O5 and a molecular weight of 590.72 g/mol. Its IUPAC name is ethyl 3-[[4-[[2-(4-tert-butylphenoxy)-1-(9H-fluoren-2-yl)-2-oxoethyl]amino]benzoyl]amino]propanoate.
| Compound Name | ethyl 3-[[4-[[2-(4-tert-butylphenoxy)-1-(9H-fluoren-2-yl)-2-oxoethyl]amino]benzoyl]amino]propanoate |
|---|---|
| PubChem CID | 91126678 |
| Molecular Formula | C37H38N2O5 |
| Molecular Weight | 590.72 g/mol |
| Exact Mass | 590.28 |
| IUPAC Name | ethyl 3-[[4-[[2-(4-tert-butylphenoxy)-1-(9H-fluoren-2-yl)-2-oxoethyl]amino]benzoyl]amino]propanoate |
| SMILES | CCOC(=O)CCNC(=O)c1ccc(NC(C(=O)Oc2ccc(C(C)(C)C)cc2)c2ccc3c(c2)Cc2ccccc2-3)cc1 |
| InChI | InChI=1S/C37H38N2O5/c1-5-43-33(40)20-21-38-35(41)24-10-15-29(16-11-24)39-34(36(42)44-30-17-13-28(14-18-30)37(2,3)4)26-12-19-32-27(23-26)22-25-8-6-7-9-31(25)32/h6-19,23,34,39H,5,20-22H2,1-4H3,(H,38,41) |
| InChIKey | IFLJUXPSRLXISC-UHFFFAOYSA-N |
| XLogP | 7.00 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 590.72 |
| LogP ≤ 5 | 7.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|