C8H9NO9S — CID 91128956
4-(2,5-dihydroxy-3-sulfopyrrol-1-yl)oxy-4-oxobutanoic acid (PubChem CID 91128956) has the molecular formula C8H9NO9S and a molecular weight of 295.23 g/mol. Its IUPAC name is 4-(2,5-dihydroxy-3-sulfopyrrol-1-yl)oxy-4-oxobutanoic acid.
| Compound Name | 4-(2,5-dihydroxy-3-sulfopyrrol-1-yl)oxy-4-oxobutanoic acid |
|---|---|
| PubChem CID | 91128956 |
| Molecular Formula | C8H9NO9S |
| Molecular Weight | 295.23 g/mol |
| Exact Mass | 295.00 |
| IUPAC Name | 4-(2,5-dihydroxy-3-sulfopyrrol-1-yl)oxy-4-oxobutanoic acid |
| SMILES | O=C(O)CCC(=O)On1c(O)cc(S(=O)(=O)O)c1O |
| InChI | InChI=1S/C8H9NO9S/c10-5-3-4(19(15,16)17)8(14)9(5)18-7(13)2-1-6(11)12/h3,10,14H,1-2H2,(H,11,12)(H,15,16,17) |
| InChIKey | XSLNOMVHDGLTNQ-UHFFFAOYSA-N |
| XLogP | -1.03 |
| TPSA | 163.36 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.23 |
| LogP ≤ 5 | -1.03 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|