C20H19ClF2N4O3S — CID 91131325
5-[[3-chloro-5-(1,1-difluoroethyl)-2-[3-(3-methyl-1,2,4-oxadiazol-5-yl)piperidin-1-yl]phenyl]methylidene]-1,3-thiazolidine-2,4-dione (PubChem CID 91131325) has the molecular formula C20H19ClF2N4O3S and a molecular weight of 468.91 g/mol. Its IUPAC name is 5-[[3-chloro-5-(1,1-difluoroethyl)-2-[3-(3-methyl-1,2,4-oxadiazol-5-yl)piperidin-1-yl]phenyl]methylidene]-1,3-thiazolidine-2,4-dione.
| Compound Name | 5-[[3-chloro-5-(1,1-difluoroethyl)-2-[3-(3-methyl-1,2,4-oxadiazol-5-yl)piperidin-1-yl]phenyl]methylidene]-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 91131325 |
| Molecular Formula | C20H19ClF2N4O3S |
| Molecular Weight | 468.91 g/mol |
| Exact Mass | 468.08 |
| IUPAC Name | 5-[[3-chloro-5-(1,1-difluoroethyl)-2-[3-(3-methyl-1,2,4-oxadiazol-5-yl)piperidin-1-yl]phenyl]methylidene]-1,3-thiazolidine-2,4-dione |
| SMILES | Cc1noc(C2CCCN(c3c(Cl)cc(C(C)(F)F)cc3C=C3SC(=O)NC3=O)C2)n1 |
| InChI | InChI=1S/C20H19ClF2N4O3S/c1-10-24-18(30-26-10)11-4-3-5-27(9-11)16-12(7-15-17(28)25-19(29)31-15)6-13(8-14(16)21)20(2,22)23/h6-8,11H,3-5,9H2,1-2H3,(H,25,28,29) |
| InChIKey | OREDSOPNBAKFKK-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 88.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.91 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|