C20H24ClF2N3O2S — CID 90863682
5-[[2-(4-tert-butylpiperazin-1-yl)-3-chloro-5-(1,1-difluoroethyl)phenyl]methylidene]-1,3-thiazolidine-2,4-dione (PubChem CID 90863682) has the molecular formula C20H24ClF2N3O2S and a molecular weight of 443.95 g/mol. Its IUPAC name is 5-[[2-(4-tert-butylpiperazin-1-yl)-3-chloro-5-(1,1-difluoroethyl)phenyl]methylidene]-1,3-thiazolidine-2,4-dione.
| Compound Name | 5-[[2-(4-tert-butylpiperazin-1-yl)-3-chloro-5-(1,1-difluoroethyl)phenyl]methylidene]-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 90863682 |
| Molecular Formula | C20H24ClF2N3O2S |
| Molecular Weight | 443.95 g/mol |
| Exact Mass | 443.12 |
| IUPAC Name | 5-[[2-(4-tert-butylpiperazin-1-yl)-3-chloro-5-(1,1-difluoroethyl)phenyl]methylidene]-1,3-thiazolidine-2,4-dione |
| SMILES | CC(F)(F)c1cc(Cl)c(N2CCN(C(C)(C)C)CC2)c(C=C2SC(=O)NC2=O)c1 |
| InChI | InChI=1S/C20H24ClF2N3O2S/c1-19(2,3)26-7-5-25(6-8-26)16-12(10-15-17(27)24-18(28)29-15)9-13(11-14(16)21)20(4,22)23/h9-11H,5-8H2,1-4H3,(H,24,27,28) |
| InChIKey | JXWVWGNIICMSFB-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.95 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|