C21H16ClF4N3O2S — CID 76782366
5-[[3-chloro-2-[4-(4-fluorophenyl)piperazin-1-yl]-5-(trifluoromethyl)phenyl]methylidene]-1,3-thiazolidine-2,4-dione (PubChem CID 76782366) has the molecular formula C21H16ClF4N3O2S and a molecular weight of 485.89 g/mol. Its IUPAC name is 5-[[3-chloro-2-[4-(4-fluorophenyl)piperazin-1-yl]-5-(trifluoromethyl)phenyl]methylidene]-1,3-thiazolidine-2,4-dione.
| Compound Name | 5-[[3-chloro-2-[4-(4-fluorophenyl)piperazin-1-yl]-5-(trifluoromethyl)phenyl]methylidene]-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 76782366 |
| Molecular Formula | C21H16ClF4N3O2S |
| Molecular Weight | 485.89 g/mol |
| Exact Mass | 485.06 |
| IUPAC Name | 5-[[3-chloro-2-[4-(4-fluorophenyl)piperazin-1-yl]-5-(trifluoromethyl)phenyl]methylidene]-1,3-thiazolidine-2,4-dione |
| SMILES | O=C1NC(=O)C(=Cc2cc(C(F)(F)F)cc(Cl)c2N2CCN(c3ccc(F)cc3)CC2)S1 |
| InChI | InChI=1S/C21H16ClF4N3O2S/c22-16-11-13(21(24,25)26)9-12(10-17-19(30)27-20(31)32-17)18(16)29-7-5-28(6-8-29)15-3-1-14(23)2-4-15/h1-4,9-11H,5-8H2,(H,27,30,31) |
| InChIKey | QZNLFERGYQSRSW-UHFFFAOYSA-N |
| XLogP | 5.15 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.89 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|