C20H21ClF3N3O2S — CID 44610259
(5Z)-5-[[3-chloro-2-(4-pyrrolidin-1-ylpiperidin-1-yl)-5-(trifluoromethyl)phenyl]methylidene]-1,3-thiazolidine-2,4-dione (PubChem CID 44610259) has the molecular formula C20H21ClF3N3O2S and a molecular weight of 459.92 g/mol. Its IUPAC name is (5Z)-5-[[3-chloro-2-(4-pyrrolidin-1-ylpiperidin-1-yl)-5-(trifluoromethyl)phenyl]methylidene]-1,3-thiazolidine-2,4-dione.
| Compound Name | (5Z)-5-[[3-chloro-2-(4-pyrrolidin-1-ylpiperidin-1-yl)-5-(trifluoromethyl)phenyl]methylidene]-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 44610259 |
| Molecular Formula | C20H21ClF3N3O2S |
| Molecular Weight | 459.92 g/mol |
| Exact Mass | 459.10 |
| IUPAC Name | (5Z)-5-[[3-chloro-2-(4-pyrrolidin-1-ylpiperidin-1-yl)-5-(trifluoromethyl)phenyl]methylidene]-1,3-thiazolidine-2,4-dione |
| SMILES | O=C1NC(=O)/C(=C/c2cc(C(F)(F)F)cc(Cl)c2N2CCC(N3CCCC3)CC2)S1 |
| InChI | InChI=1S/C20H21ClF3N3O2S/c21-15-11-13(20(22,23)24)9-12(10-16-18(28)25-19(29)30-16)17(15)27-7-3-14(4-8-27)26-5-1-2-6-26/h9-11,14H,1-8H2,(H,25,28,29)/b16-10- |
| InChIKey | SNMVUVIOJOQAHG-YBEGLDIGSA-N |
| XLogP | 4.75 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.92 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|