C18H19ClF3N3O3S — CID 44608517
(5Z)-5-[[3-chloro-2-[4-(2-hydroxyethyl)-1,4-diazepan-1-yl]-5-(trifluoromethyl)phenyl]methylidene]-1,3-thiazolidine-2,4-dione (PubChem CID 44608517) has the molecular formula C18H19ClF3N3O3S and a molecular weight of 449.88 g/mol. Its IUPAC name is (5Z)-5-[[3-chloro-2-[4-(2-hydroxyethyl)-1,4-diazepan-1-yl]-5-(trifluoromethyl)phenyl]methylidene]-1,3-thiazolidine-2,4-dione.
| Compound Name | (5Z)-5-[[3-chloro-2-[4-(2-hydroxyethyl)-1,4-diazepan-1-yl]-5-(trifluoromethyl)phenyl]methylidene]-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 44608517 |
| Molecular Formula | C18H19ClF3N3O3S |
| Molecular Weight | 449.88 g/mol |
| Exact Mass | 449.08 |
| IUPAC Name | (5Z)-5-[[3-chloro-2-[4-(2-hydroxyethyl)-1,4-diazepan-1-yl]-5-(trifluoromethyl)phenyl]methylidene]-1,3-thiazolidine-2,4-dione |
| SMILES | O=C1NC(=O)/C(=C/c2cc(C(F)(F)F)cc(Cl)c2N2CCCN(CCO)CC2)S1 |
| InChI | InChI=1S/C18H19ClF3N3O3S/c19-13-10-12(18(20,21)22)8-11(9-14-16(27)23-17(28)29-14)15(13)25-3-1-2-24(4-5-25)6-7-26/h8-10,26H,1-7H2,(H,23,27,28)/b14-9- |
| InChIKey | RLUWZNJWIKLKCP-ZROIWOOFSA-N |
| XLogP | 3.19 |
| TPSA | 72.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.88 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|