C22H29N4O7P2+ — CID 91132408
[2-amino-1-(phosphanyloxymethyl)-3-[3-[[4-(pyridin-2-yloxymethyl)phenyl]methyl]-1,2-oxazol-5-yl]piperidin-1-ium-1-yl] dihydrogen phosphate (PubChem CID 91132408) has the molecular formula C22H29N4O7P2+ and a molecular weight of 523.44 g/mol. Its IUPAC name is [2-amino-1-(phosphanyloxymethyl)-3-[3-[[4-(pyridin-2-yloxymethyl)phenyl]methyl]-1,2-oxazol-5-yl]piperidin-1-ium-1-yl] dihydrogen phosphate.
| Compound Name | [2-amino-1-(phosphanyloxymethyl)-3-[3-[[4-(pyridin-2-yloxymethyl)phenyl]methyl]-1,2-oxazol-5-yl]piperidin-1-ium-1-yl] dihydrogen phosphate |
|---|---|
| PubChem CID | 91132408 |
| Molecular Formula | C22H29N4O7P2+ |
| Molecular Weight | 523.44 g/mol |
| Exact Mass | 523.15 |
| IUPAC Name | [2-amino-1-(phosphanyloxymethyl)-3-[3-[[4-(pyridin-2-yloxymethyl)phenyl]methyl]-1,2-oxazol-5-yl]piperidin-1-ium-1-yl] dihydrogen phosphate |
| SMILES | NC1C(c2cc(Cc3ccc(COc4ccccn4)cc3)no2)CCC[N+]1(COP)OP(=O)(O)O |
| InChI | InChI=1S/C22H28N4O7P2/c23-22-19(4-3-11-26(22,15-31-34)33-35(27,28)29)20-13-18(25-32-20)12-16-6-8-17(9-7-16)14-30-21-5-1-2-10-24-21/h1-2,5-10,13,19,22H,3-4,11-12,14-15,23,34H2,(H-,27,28,29)/p+1 |
| InChIKey | HKCUNXFLEJMDAX-UHFFFAOYSA-O |
| XLogP | 3.01 |
| TPSA | 150.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.44 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|