C25H56O7 — CID 91132996
butane-1,2-diol;4-ethyl-4-(4-hydroxybutan-2-yl)-3,5-dimethylheptane-1,7-diol;2-(2-methylpropoxy)ethanol (PubChem CID 91132996) has the molecular formula C25H56O7 and a molecular weight of 468.72 g/mol. Its IUPAC name is butane-1,2-diol;4-ethyl-4-(4-hydroxybutan-2-yl)-3,5-dimethylheptane-1,7-diol;2-(2-methylpropoxy)ethanol.
| Compound Name | butane-1,2-diol;4-ethyl-4-(4-hydroxybutan-2-yl)-3,5-dimethylheptane-1,7-diol;2-(2-methylpropoxy)ethanol |
|---|---|
| PubChem CID | 91132996 |
| Molecular Formula | C25H56O7 |
| Molecular Weight | 468.72 g/mol |
| Exact Mass | 468.40 |
| IUPAC Name | butane-1,2-diol;4-ethyl-4-(4-hydroxybutan-2-yl)-3,5-dimethylheptane-1,7-diol;2-(2-methylpropoxy)ethanol |
| SMILES | CC(C)COCCO.CCC(C(C)CCO)(C(C)CCO)C(C)CCO.CCC(O)CO |
| InChI | InChI=1S/C15H32O3.C6H14O2.C4H10O2/c1-5-15(12(2)6-9-16,13(3)7-10-17)14(4)8-11-18;1-6(2)5-8-4-3-7;1-2-4(6)3-5/h12-14,16-18H,5-11H2,1-4H3;6-7H,3-5H2,1-2H3;4-6H,2-3H2,1H3 |
| InChIKey | YNWSLZVHZGKQGT-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 130.61 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.72 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|