C42H71NO2 — CID 91138313
3-(5-butyl-4,5,8-triethyl-8-methyl-6-phenylundecan-4-yl)-4-(3-methylhexan-3-yl)-1-prop-2-enylpyrrole-2,5-diol (PubChem CID 91138313) has the molecular formula C42H71NO2 and a molecular weight of 622.04 g/mol. Its IUPAC name is 3-(5-butyl-4,5,8-triethyl-8-methyl-6-phenylundecan-4-yl)-4-(3-methylhexan-3-yl)-1-prop-2-enylpyrrole-2,5-diol.
| Compound Name | 3-(5-butyl-4,5,8-triethyl-8-methyl-6-phenylundecan-4-yl)-4-(3-methylhexan-3-yl)-1-prop-2-enylpyrrole-2,5-diol |
|---|---|
| PubChem CID | 91138313 |
| Molecular Formula | C42H71NO2 |
| Molecular Weight | 622.04 g/mol |
| Exact Mass | 621.55 |
| IUPAC Name | 3-(5-butyl-4,5,8-triethyl-8-methyl-6-phenylundecan-4-yl)-4-(3-methylhexan-3-yl)-1-prop-2-enylpyrrole-2,5-diol |
| SMILES | C=CCn1c(O)c(C(C)(CC)CCC)c(C(CC)(CCC)C(CC)(CCCC)C(CC(C)(CC)CCC)c2ccccc2)c1O |
| InChI | InChI=1S/C42H71NO2/c1-12-21-30-41(19-8,34(33-25-23-22-24-26-33)32-39(10,17-6)27-13-2)42(20-9,29-15-4)36-35(40(11,18-7)28-14-3)37(44)43(31-16-5)38(36)45/h16,22-26,34,44-45H,5,12-15,17-21,27-32H2,1-4,6-11H3 |
| InChIKey | DYDMOSIPWPLIEM-UHFFFAOYSA-N |
| XLogP | 12.98 |
| TPSA | 45.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 622.04 |
| LogP ≤ 5 | 12.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|