C14H14F3NO6S — CID 91143174
6-(3-methoxyphenyl)-4-(trifluoromethylsulfonyloxy)-3,6-dihydro-2H-pyridine-1-carboxylic acid (PubChem CID 91143174) has the molecular formula C14H14F3NO6S and a molecular weight of 381.33 g/mol. Its IUPAC name is 6-(3-methoxyphenyl)-4-(trifluoromethylsulfonyloxy)-3,6-dihydro-2H-pyridine-1-carboxylic acid.
| Compound Name | 6-(3-methoxyphenyl)-4-(trifluoromethylsulfonyloxy)-3,6-dihydro-2H-pyridine-1-carboxylic acid |
|---|---|
| PubChem CID | 91143174 |
| Molecular Formula | C14H14F3NO6S |
| Molecular Weight | 381.33 g/mol |
| Exact Mass | 381.05 |
| IUPAC Name | 6-(3-methoxyphenyl)-4-(trifluoromethylsulfonyloxy)-3,6-dihydro-2H-pyridine-1-carboxylic acid |
| SMILES | COc1cccc(C2C=C(OS(=O)(=O)C(F)(F)F)CCN2C(=O)O)c1 |
| InChI | InChI=1S/C14H14F3NO6S/c1-23-10-4-2-3-9(7-10)12-8-11(5-6-18(12)13(19)20)24-25(21,22)14(15,16)17/h2-4,7-8,12H,5-6H2,1H3,(H,19,20) |
| InChIKey | IAGKNCBNXOCNDP-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 93.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.33 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|