C23H35BrO2 — CID 91146921
5-bromopent-1-ene;2-butyl-5-methyl-2,3-dihydroinden-1-one;oxolane (PubChem CID 91146921) has the molecular formula C23H35BrO2 and a molecular weight of 423.44 g/mol. Its IUPAC name is 5-bromopent-1-ene;2-butyl-5-methyl-2,3-dihydroinden-1-one;oxolane.
| Compound Name | 5-bromopent-1-ene;2-butyl-5-methyl-2,3-dihydroinden-1-one;oxolane |
|---|---|
| PubChem CID | 91146921 |
| Molecular Formula | C23H35BrO2 |
| Molecular Weight | 423.44 g/mol |
| Exact Mass | 422.18 |
| IUPAC Name | 5-bromopent-1-ene;2-butyl-5-methyl-2,3-dihydroinden-1-one;oxolane |
| SMILES | C1CCOC1.C=CCCCBr.CCCCC1Cc2cc(C)ccc2C1=O |
| InChI | InChI=1S/C14H18O.C5H9Br.C4H8O/c1-3-4-5-11-9-12-8-10(2)6-7-13(12)14(11)15;1-2-3-4-5-6;1-2-4-5-3-1/h6-8,11H,3-5,9H2,1-2H3;2H,1,3-5H2;1-4H2 |
| InChIKey | VITFEOGREWXEPF-UHFFFAOYSA-N |
| XLogP | 6.68 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.44 |
| LogP ≤ 5 | 6.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|