C21H21ClF3N3O2 — CID 91151924
7-chloro-5-(4-methylpiperazin-1-yl)-2-[[4-(trifluoromethoxy)phenyl]methyl]isoindol-1-ol (PubChem CID 91151924) has the molecular formula C21H21ClF3N3O2 and a molecular weight of 439.87 g/mol. Its IUPAC name is 7-chloro-5-(4-methylpiperazin-1-yl)-2-[[4-(trifluoromethoxy)phenyl]methyl]isoindol-1-ol.
| Compound Name | 7-chloro-5-(4-methylpiperazin-1-yl)-2-[[4-(trifluoromethoxy)phenyl]methyl]isoindol-1-ol |
|---|---|
| PubChem CID | 91151924 |
| Molecular Formula | C21H21ClF3N3O2 |
| Molecular Weight | 439.87 g/mol |
| Exact Mass | 439.13 |
| IUPAC Name | 7-chloro-5-(4-methylpiperazin-1-yl)-2-[[4-(trifluoromethoxy)phenyl]methyl]isoindol-1-ol |
| SMILES | CN1CCN(c2cc(Cl)c3c(O)n(Cc4ccc(OC(F)(F)F)cc4)cc3c2)CC1 |
| InChI | InChI=1S/C21H21ClF3N3O2/c1-26-6-8-27(9-7-26)16-10-15-13-28(20(29)19(15)18(22)11-16)12-14-2-4-17(5-3-14)30-21(23,24)25/h2-5,10-11,13,29H,6-9,12H2,1H3 |
| InChIKey | ITJHBIWYQZYWBD-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 40.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.87 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |