C40H81N5O3 — CID 91153119
3-[3-[bis[3-oxo-3-(2,2,4,4-tetramethylpentylamino)propyl]amino]propylamino]-N-(2-ethyl-2,4,4-trimethylpentyl)propanamide (PubChem CID 91153119) has the molecular formula C40H81N5O3 and a molecular weight of 680.12 g/mol. Its IUPAC name is 3-[3-[bis[3-oxo-3-(2,2,4,4-tetramethylpentylamino)propyl]amino]propylamino]-N-(2-ethyl-2,4,4-trimethylpentyl)propanamide.
| Compound Name | 3-[3-[bis[3-oxo-3-(2,2,4,4-tetramethylpentylamino)propyl]amino]propylamino]-N-(2-ethyl-2,4,4-trimethylpentyl)propanamide |
|---|---|
| PubChem CID | 91153119 |
| Molecular Formula | C40H81N5O3 |
| Molecular Weight | 680.12 g/mol |
| Exact Mass | 679.63 |
| IUPAC Name | 3-[3-[bis[3-oxo-3-(2,2,4,4-tetramethylpentylamino)propyl]amino]propylamino]-N-(2-ethyl-2,4,4-trimethylpentyl)propanamide |
| SMILES | CCC(C)(CNC(=O)CCNCCCN(CCC(=O)NCC(C)(C)CC(C)(C)C)CCC(=O)NCC(C)(C)CC(C)(C)C)CC(C)(C)C |
| InChI | InChI=1S/C40H81N5O3/c1-16-40(15,28-37(8,9)10)31-44-32(46)18-22-41-21-17-23-45(24-19-33(47)42-29-38(11,12)26-35(2,3)4)25-20-34(48)43-30-39(13,14)27-36(5,6)7/h41H,16-31H2,1-15H3,(H,42,47)(H,43,48)(H,44,46) |
| InChIKey | NYAPKSYLOOGUBN-UHFFFAOYSA-N |
| XLogP | 7.56 |
| TPSA | 102.57 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 680.12 |
| LogP ≤ 5 | 7.56 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|