C24H32O6 — CID 91153281
[2-(dimethoxymethyl)-2-methyl-3,4-dihydrochromen-4-yl] 2-methoxy-2-phenylacetate;ethane (PubChem CID 91153281) has the molecular formula C24H32O6 and a molecular weight of 416.51 g/mol. Its IUPAC name is [2-(dimethoxymethyl)-2-methyl-3,4-dihydrochromen-4-yl] 2-methoxy-2-phenylacetate;ethane.
| Compound Name | [2-(dimethoxymethyl)-2-methyl-3,4-dihydrochromen-4-yl] 2-methoxy-2-phenylacetate;ethane |
|---|---|
| PubChem CID | 91153281 |
| Molecular Formula | C24H32O6 |
| Molecular Weight | 416.51 g/mol |
| Exact Mass | 416.22 |
| IUPAC Name | [2-(dimethoxymethyl)-2-methyl-3,4-dihydrochromen-4-yl] 2-methoxy-2-phenylacetate;ethane |
| SMILES | CC.COC(C(=O)OC1CC(C)(C(OC)OC)Oc2ccccc21)c1ccccc1 |
| InChI | InChI=1S/C22H26O6.C2H6/c1-22(21(25-3)26-4)14-18(16-12-8-9-13-17(16)28-22)27-20(23)19(24-2)15-10-6-5-7-11-15;1-2/h5-13,18-19,21H,14H2,1-4H3;1-2H3 |
| InChIKey | NEOKMXRSVKNAFZ-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.51 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|