C17H13N3O — CID 91159270
6-methyl-4-(3-methylphenyl)-8-oxa-3,5,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6,10,12-hexaene (PubChem CID 91159270) has the molecular formula C17H13N3O and a molecular weight of 275.31 g/mol. Its IUPAC name is 6-methyl-4-(3-methylphenyl)-8-oxa-3,5,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6,10,12-hexaene.
| Compound Name | 6-methyl-4-(3-methylphenyl)-8-oxa-3,5,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6,10,12-hexaene |
|---|---|
| PubChem CID | 91159270 |
| Molecular Formula | C17H13N3O |
| Molecular Weight | 275.31 g/mol |
| Exact Mass | 275.11 |
| IUPAC Name | 6-methyl-4-(3-methylphenyl)-8-oxa-3,5,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6,10,12-hexaene |
| SMILES | Cc1cccc(-c2nc(C)c3oc4ncccc4c3n2)c1 |
| InChI | InChI=1S/C17H13N3O/c1-10-5-3-6-12(9-10)16-19-11(2)15-14(20-16)13-7-4-8-18-17(13)21-15/h3-9H,1-2H3 |
| InChIKey | CBDOSQSKROEMMX-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 51.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.31 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |