C13H18O8 — CID 91160009
4-hydroxy-4-[(2S,3R,4R,5R,6S)-3,4,5,6-tetrahydroxy-3-methyloxan-2-yl]hepta-1,6-diene-3,5-dione (PubChem CID 91160009) has the molecular formula C13H18O8 and a molecular weight of 302.28 g/mol. Its IUPAC name is 4-hydroxy-4-[(2S,3R,4R,5R,6S)-3,4,5,6-tetrahydroxy-3-methyloxan-2-yl]hepta-1,6-diene-3,5-dione.
| Compound Name | 4-hydroxy-4-[(2S,3R,4R,5R,6S)-3,4,5,6-tetrahydroxy-3-methyloxan-2-yl]hepta-1,6-diene-3,5-dione |
|---|---|
| PubChem CID | 91160009 |
| Molecular Formula | C13H18O8 |
| Molecular Weight | 302.28 g/mol |
| Exact Mass | 302.10 |
| IUPAC Name | 4-hydroxy-4-[(2S,3R,4R,5R,6S)-3,4,5,6-tetrahydroxy-3-methyloxan-2-yl]hepta-1,6-diene-3,5-dione |
| SMILES | C=CC(=O)C(O)(C(=O)C=C)[C@H]1O[C@H](O)[C@H](O)[C@@H](O)[C@@]1(C)O |
| InChI | InChI=1S/C13H18O8/c1-4-6(14)13(20,7(15)5-2)11-12(3,19)9(17)8(16)10(18)21-11/h4-5,8-11,16-20H,1-2H2,3H3/t8-,9-,10+,11+,12-/m1/s1 |
| InChIKey | SRDGIRUHEGHGFN-LDMBFOFVSA-N |
| XLogP | -2.58 |
| TPSA | 144.52 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.28 |
| LogP ≤ 5 | -2.58 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|