C43H46F2N4O7S2 — CID 91166131
[2-[3-[[2-(butylsulfamoyl)phenyl]methyl]-5-fluoro-2-methylindol-1-yl]acetyl] 2-[5-fluoro-2-methyl-3-[[2-(propylsulfamoyl)phenyl]methyl]indol-1-yl]acetate (PubChem CID 91166131) has the molecular formula C43H46F2N4O7S2 and a molecular weight of 832.99 g/mol. Its IUPAC name is [2-[3-[[2-(butylsulfamoyl)phenyl]methyl]-5-fluoro-2-methylindol-1-yl]acetyl] 2-[5-fluoro-2-methyl-3-[[2-(propylsulfamoyl)phenyl]methyl]indol-1-yl]acetate.
| Compound Name | [2-[3-[[2-(butylsulfamoyl)phenyl]methyl]-5-fluoro-2-methylindol-1-yl]acetyl] 2-[5-fluoro-2-methyl-3-[[2-(propylsulfamoyl)phenyl]methyl]indol-1-yl]acetate |
|---|---|
| PubChem CID | 91166131 |
| Molecular Formula | C43H46F2N4O7S2 |
| Molecular Weight | 832.99 g/mol |
| Exact Mass | 832.28 |
| IUPAC Name | [2-[3-[[2-(butylsulfamoyl)phenyl]methyl]-5-fluoro-2-methylindol-1-yl]acetyl] 2-[5-fluoro-2-methyl-3-[[2-(propylsulfamoyl)phenyl]methyl]indol-1-yl]acetate |
| SMILES | CCCCNS(=O)(=O)c1ccccc1Cc1c(C)n(CC(=O)OC(=O)Cn2c(C)c(Cc3ccccc3S(=O)(=O)NCCC)c3cc(F)ccc32)c2ccc(F)cc12 |
| InChI | InChI=1S/C43H46F2N4O7S2/c1-5-7-21-47-58(54,55)41-15-11-9-13-31(41)23-35-29(4)49(39-19-17-33(45)25-37(35)39)27-43(51)56-42(50)26-48-28(3)34(36-24-32(44)16-18-38(36)48)22-30-12-8-10-14-40(30)57(52,53)46-20-6-2/h8-19,24-25,46-47H,5-7,20-23,26-27H2,1-4H3 |
| InChIKey | UQXMXKLVCYGMCS-UHFFFAOYSA-N |
| XLogP | 7.21 |
| TPSA | 145.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 832.99 |
| LogP ≤ 5 | 7.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|