C19H26N2O4S — CID 91166891
[[(R)-tert-butylsulfinyl]amino] (2S)-2-[(3R)-2-methyl-4-methylidene-1-oxo-3H-isoquinolin-3-yl]butanoate (PubChem CID 91166891) has the molecular formula C19H26N2O4S and a molecular weight of 378.49 g/mol. Its IUPAC name is [[(R)-tert-butylsulfinyl]amino] (2S)-2-[(3R)-2-methyl-4-methylidene-1-oxo-3H-isoquinolin-3-yl]butanoate.
| Compound Name | [[(R)-tert-butylsulfinyl]amino] (2S)-2-[(3R)-2-methyl-4-methylidene-1-oxo-3H-isoquinolin-3-yl]butanoate |
|---|---|
| PubChem CID | 91166891 |
| Molecular Formula | C19H26N2O4S |
| Molecular Weight | 378.49 g/mol |
| Exact Mass | 378.16 |
| IUPAC Name | [[(R)-tert-butylsulfinyl]amino] (2S)-2-[(3R)-2-methyl-4-methylidene-1-oxo-3H-isoquinolin-3-yl]butanoate |
| SMILES | C=C1c2ccccc2C(=O)N(C)[C@@H]1[C@H](CC)C(=O)ON[S@](=O)C(C)(C)C |
| InChI | InChI=1S/C19H26N2O4S/c1-7-13(18(23)25-20-26(24)19(3,4)5)16-12(2)14-10-8-9-11-15(14)17(22)21(16)6/h8-11,13,16,20H,2,7H2,1,3-6H3/t13-,16-,26+/m0/s1 |
| InChIKey | CPVREWSCVFIBCP-MTOJNIIGSA-N |
| XLogP | 2.69 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.49 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|