About CID 91169289
CID 91169289 (PubChem CID 91169289) has the molecular formula C20H12FN2O2S-
and a molecular weight of 363.39 g/mol.
Molecular Properties
| Compound Name | CID 91169289 |
| PubChem CID | 91169289 |
| Molecular Formula | C20H12FN2O2S- |
| Molecular Weight | 363.39 g/mol |
| Exact Mass | 363.06 |
| IUPAC Name | — |
| SMILES | O=C(/N=[S-](=O)/c1ccccc1)c1cncc(C#Cc2ccccc2F)c1 |
| InChI | InChI=1S/C20H12FN2O2S/c21-19-9-5-4-6-16(19)11-10-15-12-17(14-22-13-15)20(24)23-26(25)18-7-2-1-3-8-18/h1-9,12-14H/q-1 |
| InChIKey | VGFKUUQCFLIWLQ-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 59.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 363.39 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thiol_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze CID 91169289 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 91169289?
The IUPAC name of CID 91169289 (CID 91169289) is not available.
What is the SMILES notation for CID 91169289?
The canonical SMILES for CID 91169289 is O=C(/N=[S-](=O)/c1ccccc1)c1cncc(C#Cc2ccccc2F)c1.
What is the InChIKey of CID 91169289?
The InChIKey is VGFKUUQCFLIWLQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H12FN2O2S/c21-19-9-5-4-6-16(19)11-10-15-12-17(14-22-13-15)20(24)23-26(25)18-7-2-1-3-8-18/h1-9,12-14H/q-1.
What are the key properties of CID 91169289?
CID 91169289 has a molecular weight of 363.39 g/mol, XLogP of 3.97, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for CID 91169289 is sourced from PubChem (CID 91169289), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).