C12H15BrN2O — CID 91174910
4-(8-bromo-6,7-dihydro-5H-1,8-naphthyridin-2-yl)butan-2-one (PubChem CID 91174910) has the molecular formula C12H15BrN2O and a molecular weight of 283.17 g/mol. Its IUPAC name is 4-(8-bromo-6,7-dihydro-5H-1,8-naphthyridin-2-yl)butan-2-one.
| Compound Name | 4-(8-bromo-6,7-dihydro-5H-1,8-naphthyridin-2-yl)butan-2-one |
|---|---|
| PubChem CID | 91174910 |
| Molecular Formula | C12H15BrN2O |
| Molecular Weight | 283.17 g/mol |
| Exact Mass | 282.04 |
| IUPAC Name | 4-(8-bromo-6,7-dihydro-5H-1,8-naphthyridin-2-yl)butan-2-one |
| SMILES | CC(=O)CCc1ccc2c(n1)N(Br)CCC2 |
| InChI | InChI=1S/C12H15BrN2O/c1-9(16)4-6-11-7-5-10-3-2-8-15(13)12(10)14-11/h5,7H,2-4,6,8H2,1H3 |
| InChIKey | JZGZKNWDMPBWRQ-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 33.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.17 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|