C13H18BrN2OP — CID 20824337
1-bromo-5-(8-phosphanyl-6,7-dihydro-5H-1,8-naphthyridin-2-yl)pentan-2-one (PubChem CID 20824337) has the molecular formula C13H18BrN2OP and a molecular weight of 329.18 g/mol. Its IUPAC name is 1-bromo-5-(8-phosphanyl-6,7-dihydro-5H-1,8-naphthyridin-2-yl)pentan-2-one.
| Compound Name | 1-bromo-5-(8-phosphanyl-6,7-dihydro-5H-1,8-naphthyridin-2-yl)pentan-2-one |
|---|---|
| PubChem CID | 20824337 |
| Molecular Formula | C13H18BrN2OP |
| Molecular Weight | 329.18 g/mol |
| Exact Mass | 328.03 |
| IUPAC Name | 1-bromo-5-(8-phosphanyl-6,7-dihydro-5H-1,8-naphthyridin-2-yl)pentan-2-one |
| SMILES | O=C(CBr)CCCc1ccc2c(n1)N(P)CCC2 |
| InChI | InChI=1S/C13H18BrN2OP/c14-9-12(17)5-1-4-11-7-6-10-3-2-8-16(18)13(10)15-11/h6-7H,1-5,8-9,18H2 |
| InChIKey | KEBAZPJLRIMAJU-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 33.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.18 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|