C29H45ClN4O7 — CID 91178185
2-[(3-chlorophenyl)-[(6R)-6-[[2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-[(3R)-oxan-3-yl]propyl]carbamoyl]piperidin-3-yl]methoxy]ethylcarbamic acid (PubChem CID 91178185) has the molecular formula C29H45ClN4O7 and a molecular weight of 597.15 g/mol. Its IUPAC name is 2-[(3-chlorophenyl)-[(6R)-6-[[2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-[(3R)-oxan-3-yl]propyl]carbamoyl]piperidin-3-yl]methoxy]ethylcarbamic acid.
| Compound Name | 2-[(3-chlorophenyl)-[(6R)-6-[[2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-[(3R)-oxan-3-yl]propyl]carbamoyl]piperidin-3-yl]methoxy]ethylcarbamic acid |
|---|---|
| PubChem CID | 91178185 |
| Molecular Formula | C29H45ClN4O7 |
| Molecular Weight | 597.15 g/mol |
| Exact Mass | 596.30 |
| IUPAC Name | 2-[(3-chlorophenyl)-[(6R)-6-[[2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-[(3R)-oxan-3-yl]propyl]carbamoyl]piperidin-3-yl]methoxy]ethylcarbamic acid |
| SMILES | CC(C)(C)OC(=O)NC(CNC(=O)[C@H]1CCC(C(OCCNC(=O)O)c2cccc(Cl)c2)CN1)C[C@H]1CCCOC1 |
| InChI | InChI=1S/C29H45ClN4O7/c1-29(2,3)41-28(38)34-23(14-19-6-5-12-39-18-19)17-33-26(35)24-10-9-21(16-32-24)25(40-13-11-31-27(36)37)20-7-4-8-22(30)15-20/h4,7-8,15,19,21,23-25,31-32H,5-6,9-14,16-18H2,1-3H3,(H,33,35)(H,34,38)(H,36,37)/t19-,21?,23?,24-,25?/m1/s1 |
| InChIKey | UEPATVKSOMUVSJ-HGADJKFWSA-N |
| XLogP | 3.86 |
| TPSA | 147.25 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 597.15 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|